3-fluoro-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]benzoic acid

C10H8FN3O2S — CID 62700922

IUPAC3-fluoro-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]benzoic acid
SMILESCn1cnnc1Sc1ccc(C(=O)O)cc1F
InChIInChI=1S/C10H8FN3O2S/c1-14-5-12-13-10(14)17-8-3-2-6(9(15)16)4-7(8)11/h2-5H,1H3,(H,15,16)
InChIKeyBUHJDJZOIKGOIO-UHFFFAOYSA-N
MW253.26 g/mol
LogP1.80
Rot. Bonds3

About 3-fluoro-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]benzoic acid

3-fluoro-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]benzoic acid (PubChem CID 62700922) has the molecular formula C10H8FN3O2S and a molecular weight of 253.26 g/mol. Its IUPAC name is 3-fluoro-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]benzoic acid.

Molecular Properties

Compound Name3-fluoro-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]benzoic acid
PubChem CID62700922
Molecular FormulaC10H8FN3O2S
Molecular Weight253.26 g/mol
Exact Mass253.03
IUPAC Name3-fluoro-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]benzoic acid
SMILESCn1cnnc1Sc1ccc(C(=O)O)cc1F
InChIInChI=1S/C10H8FN3O2S/c1-14-5-12-13-10(14)17-8-3-2-6(9(15)16)4-7(8)11/h2-5H,1H3,(H,15,16)
InChIKeyBUHJDJZOIKGOIO-UHFFFAOYSA-N
XLogP1.80
TPSA68.01 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500253.26
LogP ≤ 51.80
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 3-fluoro-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-fluoro-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]benzoic acid?
The IUPAC name of 3-fluoro-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]benzoic acid (CID 62700922) is 3-fluoro-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]benzoic acid.
What is the SMILES notation for 3-fluoro-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]benzoic acid?
The canonical SMILES for 3-fluoro-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]benzoic acid is Cn1cnnc1Sc1ccc(C(=O)O)cc1F.
What is the InChIKey of 3-fluoro-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]benzoic acid?
The InChIKey is BUHJDJZOIKGOIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8FN3O2S/c1-14-5-12-13-10(14)17-8-3-2-6(9(15)16)4-7(8)11/h2-5H,1H3,(H,15,16).
What are the key properties of 3-fluoro-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]benzoic acid?
3-fluoro-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]benzoic acid has a molecular weight of 253.26 g/mol, XLogP of 1.80, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]benzoic acid is sourced from PubChem (CID 62700922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).