About (3-methylphenyl) (E)-2-phenylethenesulfonate
(3-methylphenyl) (E)-2-phenylethenesulfonate (PubChem CID 6270191) has the molecular formula C15H14O3S
and a molecular weight of 274.34 g/mol. Its IUPAC name is (3-methylphenyl) (E)-2-phenylethenesulfonate.
Molecular Properties
| Compound Name | (3-methylphenyl) (E)-2-phenylethenesulfonate |
| PubChem CID | 6270191 |
| Molecular Formula | C15H14O3S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | (3-methylphenyl) (E)-2-phenylethenesulfonate |
| SMILES | Cc1cccc(OS(=O)(=O)/C=C/c2ccccc2)c1 |
| InChI | InChI=1S/C15H14O3S/c1-13-6-5-9-15(12-13)18-19(16,17)11-10-14-7-3-2-4-8-14/h2-12H,1H3/b11-10+ |
| InChIKey | SEPMQFUPDKZGIH-ZHACJKMWSA-N |
| XLogP | 3.37 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (3-methylphenyl) (E)-2-phenylethenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methylphenyl) (E)-2-phenylethenesulfonate?
The IUPAC name of (3-methylphenyl) (E)-2-phenylethenesulfonate (CID 6270191) is (3-methylphenyl) (E)-2-phenylethenesulfonate.
What is the SMILES notation for (3-methylphenyl) (E)-2-phenylethenesulfonate?
The canonical SMILES for (3-methylphenyl) (E)-2-phenylethenesulfonate is Cc1cccc(OS(=O)(=O)/C=C/c2ccccc2)c1.
What is the InChIKey of (3-methylphenyl) (E)-2-phenylethenesulfonate?
The InChIKey is SEPMQFUPDKZGIH-ZHACJKMWSA-N. The full InChI is InChI=1S/C15H14O3S/c1-13-6-5-9-15(12-13)18-19(16,17)11-10-14-7-3-2-4-8-14/h2-12H,1H3/b11-10+.
What are the key properties of (3-methylphenyl) (E)-2-phenylethenesulfonate?
(3-methylphenyl) (E)-2-phenylethenesulfonate has a molecular weight of 274.34 g/mol, XLogP of 3.37, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methylphenyl) (E)-2-phenylethenesulfonate is sourced from PubChem (CID 6270191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).