C14H24N2OS — CID 62703728
2-methoxy-N-[(6-propan-2-yl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)methyl]ethanamine (PubChem CID 62703728) has the molecular formula C14H24N2OS and a molecular weight of 268.43 g/mol. Its IUPAC name is 2-methoxy-N-[(6-propan-2-yl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)methyl]ethanamine.
| Compound Name | 2-methoxy-N-[(6-propan-2-yl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 62703728 |
| Molecular Formula | C14H24N2OS |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 2-methoxy-N-[(6-propan-2-yl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)methyl]ethanamine |
| SMILES | COCCNCc1nc2c(s1)CC(C(C)C)CC2 |
| InChI | InChI=1S/C14H24N2OS/c1-10(2)11-4-5-12-13(8-11)18-14(16-12)9-15-6-7-17-3/h10-11,15H,4-9H2,1-3H3 |
| InChIKey | MCSGJLDKYTZDRW-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|