C35H26F6INO2S2 — CID 62705196
4-[4-[3,3,4,4,5,5-hexafluoro-2-(5-iodo-2-methylthiophen-3-yl)cyclopenten-1-yl]-5-methylthiophen-2-yl]-N,N-bis(4-methoxyphenyl)aniline (PubChem CID 62705196) has the molecular formula C35H26F6INO2S2 and a molecular weight of 797.62 g/mol. Its IUPAC name is 4-[4-[3,3,4,4,5,5-hexafluoro-2-(5-iodo-2-methylthiophen-3-yl)cyclopenten-1-yl]-5-methylthiophen-2-yl]-N,N-bis(4-methoxyphenyl)aniline.
| Compound Name | 4-[4-[3,3,4,4,5,5-hexafluoro-2-(5-iodo-2-methylthiophen-3-yl)cyclopenten-1-yl]-5-methylthiophen-2-yl]-N,N-bis(4-methoxyphenyl)aniline |
|---|---|
| PubChem CID | 62705196 |
| Molecular Formula | C35H26F6INO2S2 |
| Molecular Weight | 797.62 g/mol |
| Exact Mass | 797.04 |
| IUPAC Name | 4-[4-[3,3,4,4,5,5-hexafluoro-2-(5-iodo-2-methylthiophen-3-yl)cyclopenten-1-yl]-5-methylthiophen-2-yl]-N,N-bis(4-methoxyphenyl)aniline |
| SMILES | COc1ccc(N(c2ccc(OC)cc2)c2ccc(-c3cc(C4=C(c5cc(I)sc5C)C(F)(F)C(F)(F)C4(F)F)c(C)s3)cc2)cc1 |
| InChI | InChI=1S/C35H26F6INO2S2/c1-19-27(31-32(28-18-30(42)47-20(28)2)34(38,39)35(40,41)33(31,36)37)17-29(46-19)21-5-7-22(8-6-21)43(23-9-13-25(44-3)14-10-23)24-11-15-26(45-4)16-12-24/h5-18H,1-4H3 |
| InChIKey | PNJVUIPEOVAFPE-UHFFFAOYSA-N |
| XLogP | 12.02 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.62 |
| LogP ≤ 5 | 12.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|