About CID 62705636
CID 62705636 (PubChem CID 62705636) has the molecular formula C27H21NO3
and a molecular weight of 407.47 g/mol.
Molecular Properties
| Compound Name | CID 62705636 |
| PubChem CID | 62705636 |
| Molecular Formula | C27H21NO3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | — |
| SMILES | CN1CC(c2ccccc2)C2(Cc3ccccc3C2=O)C12C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C27H21NO3/c1-28-16-22(17-9-3-2-4-10-17)26(15-18-11-5-6-12-19(18)23(26)29)27(28)24(30)20-13-7-8-14-21(20)25(27)31/h2-14,22H,15-16H2,1H3 |
| InChIKey | GTKCKHNVQYQHTP-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze CID 62705636 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 62705636?
The IUPAC name of CID 62705636 (CID 62705636) is not available.
What is the SMILES notation for CID 62705636?
The canonical SMILES for CID 62705636 is CN1CC(c2ccccc2)C2(Cc3ccccc3C2=O)C12C(=O)c1ccccc1C2=O.
What is the InChIKey of CID 62705636?
The InChIKey is GTKCKHNVQYQHTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H21NO3/c1-28-16-22(17-9-3-2-4-10-17)26(15-18-11-5-6-12-19(18)23(26)29)27(28)24(30)20-13-7-8-14-21(20)25(27)31/h2-14,22H,15-16H2,1H3.
What are the key properties of CID 62705636?
CID 62705636 has a molecular weight of 407.47 g/mol, XLogP of 3.96, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 62705636 is sourced from PubChem (CID 62705636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).