About 4-amino-N'-(4-bromophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide
4-amino-N'-(4-bromophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 627057) has the molecular formula C9H8BrN5O2
and a molecular weight of 298.10 g/mol. Its IUPAC name is 4-amino-N'-(4-bromophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide.
Molecular Properties
| Compound Name | 4-amino-N'-(4-bromophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
| PubChem CID | 627057 |
| Molecular Formula | C9H8BrN5O2 |
| Molecular Weight | 298.10 g/mol |
| Exact Mass | 296.99 |
| IUPAC Name | 4-amino-N'-(4-bromophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | Nc1nonc1/C(=N/c1ccc(Br)cc1)NO |
| InChI | InChI=1S/C9H8BrN5O2/c10-5-1-3-6(4-2-5)12-9(13-16)7-8(11)15-17-14-7/h1-4,16H,(H2,11,15)(H,12,13) |
| InChIKey | SPPFXXXDLJDNHI-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 109.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.10 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-N'-(4-bromophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N'-(4-bromophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide?
The IUPAC name of 4-amino-N'-(4-bromophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide (CID 627057) is 4-amino-N'-(4-bromophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide.
What is the SMILES notation for 4-amino-N'-(4-bromophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide?
The canonical SMILES for 4-amino-N'-(4-bromophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide is Nc1nonc1/C(=N/c1ccc(Br)cc1)NO.
What is the InChIKey of 4-amino-N'-(4-bromophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide?
The InChIKey is SPPFXXXDLJDNHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrN5O2/c10-5-1-3-6(4-2-5)12-9(13-16)7-8(11)15-17-14-7/h1-4,16H,(H2,11,15)(H,12,13).
What are the key properties of 4-amino-N'-(4-bromophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide?
4-amino-N'-(4-bromophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide has a molecular weight of 298.10 g/mol, XLogP of 1.47, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N'-(4-bromophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide is sourced from PubChem (CID 627057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).