C24H25N5O3S — CID 62705833
(2-pyridin-4-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-(1-quinolin-5-ylsulfonylazetidin-3-yl)methanone (PubChem CID 62705833) has the molecular formula C24H25N5O3S and a molecular weight of 463.56 g/mol. Its IUPAC name is (2-pyridin-4-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-(1-quinolin-5-ylsulfonylazetidin-3-yl)methanone.
| Compound Name | (2-pyridin-4-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-(1-quinolin-5-ylsulfonylazetidin-3-yl)methanone |
|---|---|
| PubChem CID | 62705833 |
| Molecular Formula | C24H25N5O3S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | (2-pyridin-4-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-(1-quinolin-5-ylsulfonylazetidin-3-yl)methanone |
| SMILES | O=C(C1CN(S(=O)(=O)c2cccc3ncccc23)C1)N1CC2CN(c3ccncc3)CC2C1 |
| InChI | InChI=1S/C24H25N5O3S/c30-24(28-13-17-11-27(12-18(17)14-28)20-6-9-25-10-7-20)19-15-29(16-19)33(31,32)23-5-1-4-22-21(23)3-2-8-26-22/h1-10,17-19H,11-16H2 |
| InChIKey | TWSLIEXKXHDZJX-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 86.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |