C23H32O5 — CID 62705927
ditert-butyl (4S,5S)-4-ethenyl-10-methyl-8-oxospiro[4.5]deca-6,9-diene-2,2-dicarboxylate (PubChem CID 62705927) has the molecular formula C23H32O5 and a molecular weight of 388.50 g/mol. Its IUPAC name is ditert-butyl (4S,5S)-4-ethenyl-10-methyl-8-oxospiro[4.5]deca-6,9-diene-2,2-dicarboxylate.
| Compound Name | ditert-butyl (4S,5S)-4-ethenyl-10-methyl-8-oxospiro[4.5]deca-6,9-diene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 62705927 |
| Molecular Formula | C23H32O5 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | ditert-butyl (4S,5S)-4-ethenyl-10-methyl-8-oxospiro[4.5]deca-6,9-diene-2,2-dicarboxylate |
| SMILES | C=C[C@@H]1CC(C(=O)OC(C)(C)C)(C(=O)OC(C)(C)C)C[C@]12C=CC(=O)C=C2C |
| InChI | InChI=1S/C23H32O5/c1-9-16-13-23(18(25)27-20(3,4)5,19(26)28-21(6,7)8)14-22(16)11-10-17(24)12-15(22)2/h9-12,16H,1,13-14H2,2-8H3/t16-,22+/m1/s1 |
| InChIKey | FGESGBOQLMDMBK-ZHRRBRCNSA-N |
| XLogP | 4.32 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|