C24H22N2O7 — CID 62706257
diethyl 2-(4-nitrophenyl)-2,11b-dihydro-[1,3]oxazino[2,3-a]isoquinoline-3,4-dicarboxylate (PubChem CID 62706257) has the molecular formula C24H22N2O7 and a molecular weight of 450.45 g/mol. Its IUPAC name is diethyl 2-(4-nitrophenyl)-2,11b-dihydro-[1,3]oxazino[2,3-a]isoquinoline-3,4-dicarboxylate.
| Compound Name | diethyl 2-(4-nitrophenyl)-2,11b-dihydro-[1,3]oxazino[2,3-a]isoquinoline-3,4-dicarboxylate |
|---|---|
| PubChem CID | 62706257 |
| Molecular Formula | C24H22N2O7 |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | diethyl 2-(4-nitrophenyl)-2,11b-dihydro-[1,3]oxazino[2,3-a]isoquinoline-3,4-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)N2C=Cc3ccccc3C2OC1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H22N2O7/c1-3-31-23(27)19-20(24(28)32-4-2)25-14-13-15-7-5-6-8-18(15)22(25)33-21(19)16-9-11-17(12-10-16)26(29)30/h5-14,21-22H,3-4H2,1-2H3 |
| InChIKey | XWBUWUUNFJMKCC-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|