C12H16O3 — CID 62706297
(3'aR,7'aS)-7'a-methylspiro[1,3-dioxolane-2,5'-3a,4,6,7-tetrahydroindene]-1'-one (PubChem CID 62706297) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is (3'aR,7'aS)-7'a-methylspiro[1,3-dioxolane-2,5'-3a,4,6,7-tetrahydroindene]-1'-one.
| Compound Name | (3'aR,7'aS)-7'a-methylspiro[1,3-dioxolane-2,5'-3a,4,6,7-tetrahydroindene]-1'-one |
|---|---|
| PubChem CID | 62706297 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | (3'aR,7'aS)-7'a-methylspiro[1,3-dioxolane-2,5'-3a,4,6,7-tetrahydroindene]-1'-one |
| SMILES | C[C@]12CCC3(C[C@@H]1C=CC2=O)OCCO3 |
| InChI | InChI=1S/C12H16O3/c1-11-4-5-12(14-6-7-15-12)8-9(11)2-3-10(11)13/h2-3,9H,4-8H2,1H3/t9-,11-/m0/s1 |
| InChIKey | LVRRAZFWGJRIQI-ONGXEEELSA-N |
| XLogP | 1.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |