C15H22O3 — CID 62706298
(3'R,3'aR,7'aS)-7'a-methyl-3'-prop-1-en-2-ylspiro[1,3-dioxolane-2,5'-2,3,3a,4,6,7-hexahydroindene]-1'-one (PubChem CID 62706298) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (3'R,3'aR,7'aS)-7'a-methyl-3'-prop-1-en-2-ylspiro[1,3-dioxolane-2,5'-2,3,3a,4,6,7-hexahydroindene]-1'-one.
| Compound Name | (3'R,3'aR,7'aS)-7'a-methyl-3'-prop-1-en-2-ylspiro[1,3-dioxolane-2,5'-2,3,3a,4,6,7-hexahydroindene]-1'-one |
|---|---|
| PubChem CID | 62706298 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (3'R,3'aR,7'aS)-7'a-methyl-3'-prop-1-en-2-ylspiro[1,3-dioxolane-2,5'-2,3,3a,4,6,7-hexahydroindene]-1'-one |
| SMILES | C=C(C)[C@@H]1CC(=O)[C@@]2(C)CCC3(C[C@H]12)OCCO3 |
| InChI | InChI=1S/C15H22O3/c1-10(2)11-8-13(16)14(3)4-5-15(9-12(11)14)17-6-7-18-15/h11-12H,1,4-9H2,2-3H3/t11-,12+,14-/m0/s1 |
| InChIKey | IYMUQQZYOITXJO-SCRDCRAPSA-N |
| XLogP | 2.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|