About [2-[4-amino-2-(carbamimidoylsulfanylmethyl)phenyl]sulfanylphenyl]methyl carbamimidothioate;hydrobromide
[2-[4-amino-2-(carbamimidoylsulfanylmethyl)phenyl]sulfanylphenyl]methyl carbamimidothioate;hydrobromide (PubChem CID 62706347) has the molecular formula C16H20BrN5S3
and a molecular weight of 458.48 g/mol. Its IUPAC name is [2-[4-amino-2-(carbamimidoylsulfanylmethyl)phenyl]sulfanylphenyl]methyl carbamimidothioate;hydrobromide.
Molecular Properties
| Compound Name | [2-[4-amino-2-(carbamimidoylsulfanylmethyl)phenyl]sulfanylphenyl]methyl carbamimidothioate;hydrobromide |
| PubChem CID | 62706347 |
| Molecular Formula | C16H20BrN5S3 |
| Molecular Weight | 458.48 g/mol |
| Exact Mass | 457.01 |
| IUPAC Name | [2-[4-amino-2-(carbamimidoylsulfanylmethyl)phenyl]sulfanylphenyl]methyl carbamimidothioate;hydrobromide |
| SMILES | Br.[H]/N=C(\N)SCc1ccccc1Sc1ccc(N)cc1CS/C(N)=N/[H] |
| InChI | InChI=1S/C16H19N5S3.BrH/c17-12-5-6-14(11(7-12)9-23-16(20)21)24-13-4-2-1-3-10(13)8-22-15(18)19;/h1-7H,8-9,17H2,(H3,18,19)(H3,20,21);1H |
| InChIKey | SYBAOGDJMZYOHH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 125.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 458.48 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [2-[4-amino-2-(carbamimidoylsulfanylmethyl)phenyl]sulfanylphenyl]methyl carbamimidothioate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[4-amino-2-(carbamimidoylsulfanylmethyl)phenyl]sulfanylphenyl]methyl carbamimidothioate;hydrobromide?
The IUPAC name of [2-[4-amino-2-(carbamimidoylsulfanylmethyl)phenyl]sulfanylphenyl]methyl carbamimidothioate;hydrobromide (CID 62706347) is [2-[4-amino-2-(carbamimidoylsulfanylmethyl)phenyl]sulfanylphenyl]methyl carbamimidothioate;hydrobromide.
What is the SMILES notation for [2-[4-amino-2-(carbamimidoylsulfanylmethyl)phenyl]sulfanylphenyl]methyl carbamimidothioate;hydrobromide?
The canonical SMILES for [2-[4-amino-2-(carbamimidoylsulfanylmethyl)phenyl]sulfanylphenyl]methyl carbamimidothioate;hydrobromide is Br.[H]/N=C(\N)SCc1ccccc1Sc1ccc(N)cc1CS/C(N)=N/[H].
What is the InChIKey of [2-[4-amino-2-(carbamimidoylsulfanylmethyl)phenyl]sulfanylphenyl]methyl carbamimidothioate;hydrobromide?
The InChIKey is SYBAOGDJMZYOHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N5S3.BrH/c17-12-5-6-14(11(7-12)9-23-16(20)21)24-13-4-2-1-3-10(13)8-22-15(18)19;/h1-7H,8-9,17H2,(H3,18,19)(H3,20,21);1H.
What are the key properties of [2-[4-amino-2-(carbamimidoylsulfanylmethyl)phenyl]sulfanylphenyl]methyl carbamimidothioate;hydrobromide?
[2-[4-amino-2-(carbamimidoylsulfanylmethyl)phenyl]sulfanylphenyl]methyl carbamimidothioate;hydrobromide has a molecular weight of 458.48 g/mol, XLogP of 4.25, 6 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[4-amino-2-(carbamimidoylsulfanylmethyl)phenyl]sulfanylphenyl]methyl carbamimidothioate;hydrobromide is sourced from PubChem (CID 62706347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).