C28H25NOS — CID 62706377
(E,2S)-4-methyl-2-[2-[(S)-(4-methylphenyl)sulfinyl]phenyl]-5-phenyl-2-prop-2-ynylpent-4-enenitrile (PubChem CID 62706377) has the molecular formula C28H25NOS and a molecular weight of 423.58 g/mol. Its IUPAC name is (E,2S)-4-methyl-2-[2-[(S)-(4-methylphenyl)sulfinyl]phenyl]-5-phenyl-2-prop-2-ynylpent-4-enenitrile.
| Compound Name | (E,2S)-4-methyl-2-[2-[(S)-(4-methylphenyl)sulfinyl]phenyl]-5-phenyl-2-prop-2-ynylpent-4-enenitrile |
|---|---|
| PubChem CID | 62706377 |
| Molecular Formula | C28H25NOS |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | (E,2S)-4-methyl-2-[2-[(S)-(4-methylphenyl)sulfinyl]phenyl]-5-phenyl-2-prop-2-ynylpent-4-enenitrile |
| SMILES | C#CC[C@](C#N)(C/C(C)=C/c1ccccc1)c1ccccc1[S@@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C28H25NOS/c1-4-18-28(21-29,20-23(3)19-24-10-6-5-7-11-24)26-12-8-9-13-27(26)31(30)25-16-14-22(2)15-17-25/h1,5-17,19H,18,20H2,2-3H3/b23-19+/t28-,31+/m1/s1 |
| InChIKey | RLYXSDPSDPRBJK-MPDWXNECSA-N |
| XLogP | 6.44 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|