About (1-deuterio-2,2-difluoroethenyl) N,N-diethylcarbamate
(1-deuterio-2,2-difluoroethenyl) N,N-diethylcarbamate (PubChem CID 62706525) has the molecular formula C7H11F2NO2
and a molecular weight of 180.17 g/mol. Its IUPAC name is (1-deuterio-2,2-difluoroethenyl) N,N-diethylcarbamate.
Molecular Properties
| Compound Name | (1-deuterio-2,2-difluoroethenyl) N,N-diethylcarbamate |
| PubChem CID | 62706525 |
| Molecular Formula | C7H11F2NO2 |
| Molecular Weight | 180.17 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | (1-deuterio-2,2-difluoroethenyl) N,N-diethylcarbamate |
| SMILES | [2H]C(OC(=O)N(CC)CC)=C(F)F |
| InChI | InChI=1S/C7H11F2NO2/c1-3-10(4-2)7(11)12-5-6(8)9/h5H,3-4H2,1-2H3/i5D |
| InChIKey | FLOPJCARDFFPIX-UICOGKGYSA-N |
| XLogP | 2.20 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.17 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (1-deuterio-2,2-difluoroethenyl) N,N-diethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-deuterio-2,2-difluoroethenyl) N,N-diethylcarbamate?
The IUPAC name of (1-deuterio-2,2-difluoroethenyl) N,N-diethylcarbamate (CID 62706525) is (1-deuterio-2,2-difluoroethenyl) N,N-diethylcarbamate.
What is the SMILES notation for (1-deuterio-2,2-difluoroethenyl) N,N-diethylcarbamate?
The canonical SMILES for (1-deuterio-2,2-difluoroethenyl) N,N-diethylcarbamate is [2H]C(OC(=O)N(CC)CC)=C(F)F.
What is the InChIKey of (1-deuterio-2,2-difluoroethenyl) N,N-diethylcarbamate?
The InChIKey is FLOPJCARDFFPIX-UICOGKGYSA-N. The full InChI is InChI=1S/C7H11F2NO2/c1-3-10(4-2)7(11)12-5-6(8)9/h5H,3-4H2,1-2H3/i5D.
What are the key properties of (1-deuterio-2,2-difluoroethenyl) N,N-diethylcarbamate?
(1-deuterio-2,2-difluoroethenyl) N,N-diethylcarbamate has a molecular weight of 180.17 g/mol, XLogP of 2.20, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-deuterio-2,2-difluoroethenyl) N,N-diethylcarbamate is sourced from PubChem (CID 62706525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).