C38H50N6O2 — CID 62706599
9,18-dihexyl-5,14-dipentyl-6,7,9,15,16,18-hexazahexacyclo[11.7.1.14,20.02,11.03,8.017,21]docosa-1(21),2(11),3(8),4,6,12,14,16,20(22)-nonaene-10,19-dione (PubChem CID 62706599) has the molecular formula C38H50N6O2 and a molecular weight of 622.86 g/mol. Its IUPAC name is 9,18-dihexyl-5,14-dipentyl-6,7,9,15,16,18-hexazahexacyclo[11.7.1.14,20.02,11.03,8.017,21]docosa-1(21),2(11),3(8),4,6,12,14,16,20(22)-nonaene-10,19-dione.
| Compound Name | 9,18-dihexyl-5,14-dipentyl-6,7,9,15,16,18-hexazahexacyclo[11.7.1.14,20.02,11.03,8.017,21]docosa-1(21),2(11),3(8),4,6,12,14,16,20(22)-nonaene-10,19-dione |
|---|---|
| PubChem CID | 62706599 |
| Molecular Formula | C38H50N6O2 |
| Molecular Weight | 622.86 g/mol |
| Exact Mass | 622.40 |
| IUPAC Name | 9,18-dihexyl-5,14-dipentyl-6,7,9,15,16,18-hexazahexacyclo[11.7.1.14,20.02,11.03,8.017,21]docosa-1(21),2(11),3(8),4,6,12,14,16,20(22)-nonaene-10,19-dione |
| SMILES | CCCCCCn1c(=O)c2cc3c(CCCCC)nnc4c3c3c(cc5c(CCCCC)nnc1c5c23)c(=O)n4CCCCCC |
| InChI | InChI=1S/C38H50N6O2/c1-5-9-13-17-21-43-35-33-25(29(39-41-35)19-15-11-7-3)24-28-32-31(33)27(37(43)45)23-26-30(20-16-12-8-4)40-42-36(34(26)32)44(38(28)46)22-18-14-10-6-2/h23-24H,5-22H2,1-4H3 |
| InChIKey | JOXVVTNESAAPBE-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 95.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.86 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|