About 1,1-difluoro-2-(2-methoxyethoxymethoxy)buta-1,3-diene
1,1-difluoro-2-(2-methoxyethoxymethoxy)buta-1,3-diene (PubChem CID 62706708) has the molecular formula C8H12F2O3
and a molecular weight of 194.18 g/mol. Its IUPAC name is 1,1-difluoro-2-(2-methoxyethoxymethoxy)buta-1,3-diene.
Molecular Properties
| Compound Name | 1,1-difluoro-2-(2-methoxyethoxymethoxy)buta-1,3-diene |
| PubChem CID | 62706708 |
| Molecular Formula | C8H12F2O3 |
| Molecular Weight | 194.18 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | 1,1-difluoro-2-(2-methoxyethoxymethoxy)buta-1,3-diene |
| SMILES | C=CC(OCOCCOC)=C(F)F |
| InChI | InChI=1S/C8H12F2O3/c1-3-7(8(9)10)13-6-12-5-4-11-2/h3H,1,4-6H2,2H3 |
| InChIKey | ANGYULVDALVODR-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.18 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1,1-difluoro-2-(2-methoxyethoxymethoxy)buta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-difluoro-2-(2-methoxyethoxymethoxy)buta-1,3-diene?
The IUPAC name of 1,1-difluoro-2-(2-methoxyethoxymethoxy)buta-1,3-diene (CID 62706708) is 1,1-difluoro-2-(2-methoxyethoxymethoxy)buta-1,3-diene.
What is the SMILES notation for 1,1-difluoro-2-(2-methoxyethoxymethoxy)buta-1,3-diene?
The canonical SMILES for 1,1-difluoro-2-(2-methoxyethoxymethoxy)buta-1,3-diene is C=CC(OCOCCOC)=C(F)F.
What is the InChIKey of 1,1-difluoro-2-(2-methoxyethoxymethoxy)buta-1,3-diene?
The InChIKey is ANGYULVDALVODR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F2O3/c1-3-7(8(9)10)13-6-12-5-4-11-2/h3H,1,4-6H2,2H3.
What are the key properties of 1,1-difluoro-2-(2-methoxyethoxymethoxy)buta-1,3-diene?
1,1-difluoro-2-(2-methoxyethoxymethoxy)buta-1,3-diene has a molecular weight of 194.18 g/mol, XLogP of 1.92, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-difluoro-2-(2-methoxyethoxymethoxy)buta-1,3-diene is sourced from PubChem (CID 62706708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).