C11H9F2NO — CID 62706950
(E)-2,2-difluoro-3-hydroxy-5-phenylpent-4-enenitrile (PubChem CID 62706950) has the molecular formula C11H9F2NO and a molecular weight of 209.20 g/mol. Its IUPAC name is (E)-2,2-difluoro-3-hydroxy-5-phenylpent-4-enenitrile.
| Compound Name | (E)-2,2-difluoro-3-hydroxy-5-phenylpent-4-enenitrile |
|---|---|
| PubChem CID | 62706950 |
| Molecular Formula | C11H9F2NO |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | (E)-2,2-difluoro-3-hydroxy-5-phenylpent-4-enenitrile |
| SMILES | N#CC(F)(F)C(O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C11H9F2NO/c12-11(13,8-14)10(15)7-6-9-4-2-1-3-5-9/h1-7,10,15H/b7-6+ |
| InChIKey | AFBIJCHPYOXLMO-VOTSOKGWSA-N |
| XLogP | 2.22 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |