C24H30F3N5O4 — CID 62707153
(1R,2S,3R,5R)-3-[[5-(5-ethylfuro[2,3-c]pyridin-2-yl)-6-methyl-2-(4,4,4-trifluorobutylamino)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol (PubChem CID 62707153) has the molecular formula C24H30F3N5O4 and a molecular weight of 509.53 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-[[5-(5-ethylfuro[2,3-c]pyridin-2-yl)-6-methyl-2-(4,4,4-trifluorobutylamino)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-[[5-(5-ethylfuro[2,3-c]pyridin-2-yl)-6-methyl-2-(4,4,4-trifluorobutylamino)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 62707153 |
| Molecular Formula | C24H30F3N5O4 |
| Molecular Weight | 509.53 g/mol |
| Exact Mass | 509.22 |
| IUPAC Name | (1R,2S,3R,5R)-3-[[5-(5-ethylfuro[2,3-c]pyridin-2-yl)-6-methyl-2-(4,4,4-trifluorobutylamino)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
| SMILES | CCc1cc2cc(-c3c(C)nc(NCCCC(F)(F)F)nc3N[C@@H]3C[C@H](CO)[C@@H](O)[C@H]3O)oc2cn1 |
| InChI | InChI=1S/C24H30F3N5O4/c1-3-15-7-13-9-17(36-18(13)10-29-15)19-12(2)30-23(28-6-4-5-24(25,26)27)32-22(19)31-16-8-14(11-33)20(34)21(16)35/h7,9-10,14,16,20-21,33-35H,3-6,8,11H2,1-2H3,(H2,28,30,31,32)/t14-,16-,20-,21+/m1/s1 |
| InChIKey | VERWYULUARLBAL-XQJRBRMLSA-N |
| XLogP | 3.42 |
| TPSA | 136.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.53 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|