C21H23N3O5 — CID 62707229
(1S,5R,6R,8S)-7-azido-6,8-bis(phenylmethoxy)-2,4-dioxabicyclo[3.3.1]nonan-9-ol (PubChem CID 62707229) has the molecular formula C21H23N3O5 and a molecular weight of 397.43 g/mol. Its IUPAC name is (1S,5R,6R,8S)-7-azido-6,8-bis(phenylmethoxy)-2,4-dioxabicyclo[3.3.1]nonan-9-ol.
| Compound Name | (1S,5R,6R,8S)-7-azido-6,8-bis(phenylmethoxy)-2,4-dioxabicyclo[3.3.1]nonan-9-ol |
|---|---|
| PubChem CID | 62707229 |
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | (1S,5R,6R,8S)-7-azido-6,8-bis(phenylmethoxy)-2,4-dioxabicyclo[3.3.1]nonan-9-ol |
| SMILES | [N-]=[N+]=NC1[C@@H](OCc2ccccc2)[C@@H]2OCO[C@@H](C2O)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C21H23N3O5/c22-24-23-16-18(26-11-14-7-3-1-4-8-14)20-17(25)21(29-13-28-20)19(16)27-12-15-9-5-2-6-10-15/h1-10,16-21,25H,11-13H2/t16?,17?,18-,19+,20-,21+ |
| InChIKey | YAGGMPVMAOICSY-CAYXJYMISA-N |
| XLogP | 2.95 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|