About 6-[(Z)-dec-1-enyl]-5,7-dimethyl-2,3-dihydro-1H-indolizin-4-ium chloride
6-[(Z)-dec-1-enyl]-5,7-dimethyl-2,3-dihydro-1H-indolizin-4-ium chloride (PubChem CID 62707283) has the molecular formula C20H32ClN
and a molecular weight of 321.94 g/mol. Its IUPAC name is 6-[(Z)-dec-1-enyl]-5,7-dimethyl-2,3-dihydro-1H-indolizin-4-ium chloride.
Molecular Properties
| Compound Name | 6-[(Z)-dec-1-enyl]-5,7-dimethyl-2,3-dihydro-1H-indolizin-4-ium chloride |
| PubChem CID | 62707283 |
| Molecular Formula | C20H32ClN |
| Molecular Weight | 321.94 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | 6-[(Z)-dec-1-enyl]-5,7-dimethyl-2,3-dihydro-1H-indolizin-4-ium chloride |
| SMILES | CCCCCCCC/C=C\c1c(C)cc2[n+](c1C)CCC2.[Cl-] |
| InChI | InChI=1S/C20H32N.ClH/c1-4-5-6-7-8-9-10-11-14-20-17(2)16-19-13-12-15-21(19)18(20)3;/h11,14,16H,4-10,12-13,15H2,1-3H3;1H/q+1;/p-1/b14-11-; |
| InChIKey | CODJFXXTEQXQLH-IRIIKGHASA-M |
| XLogP | 2.30 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.94 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 6-[(Z)-dec-1-enyl]-5,7-dimethyl-2,3-dihydro-1H-indolizin-4-ium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(Z)-dec-1-enyl]-5,7-dimethyl-2,3-dihydro-1H-indolizin-4-ium chloride?
The IUPAC name of 6-[(Z)-dec-1-enyl]-5,7-dimethyl-2,3-dihydro-1H-indolizin-4-ium chloride (CID 62707283) is 6-[(Z)-dec-1-enyl]-5,7-dimethyl-2,3-dihydro-1H-indolizin-4-ium chloride.
What is the SMILES notation for 6-[(Z)-dec-1-enyl]-5,7-dimethyl-2,3-dihydro-1H-indolizin-4-ium chloride?
The canonical SMILES for 6-[(Z)-dec-1-enyl]-5,7-dimethyl-2,3-dihydro-1H-indolizin-4-ium chloride is CCCCCCCC/C=C\c1c(C)cc2[n+](c1C)CCC2.[Cl-].
What is the InChIKey of 6-[(Z)-dec-1-enyl]-5,7-dimethyl-2,3-dihydro-1H-indolizin-4-ium chloride?
The InChIKey is CODJFXXTEQXQLH-IRIIKGHASA-M. The full InChI is InChI=1S/C20H32N.ClH/c1-4-5-6-7-8-9-10-11-14-20-17(2)16-19-13-12-15-21(19)18(20)3;/h11,14,16H,4-10,12-13,15H2,1-3H3;1H/q+1;/p-1/b14-11-;.
What are the key properties of 6-[(Z)-dec-1-enyl]-5,7-dimethyl-2,3-dihydro-1H-indolizin-4-ium chloride?
6-[(Z)-dec-1-enyl]-5,7-dimethyl-2,3-dihydro-1H-indolizin-4-ium chloride has a molecular weight of 321.94 g/mol, XLogP of 2.30, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(Z)-dec-1-enyl]-5,7-dimethyl-2,3-dihydro-1H-indolizin-4-ium chloride is sourced from PubChem (CID 62707283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).