C26H30Cl2NOP — CID 6270737
6-bis[(Z)-2-chloro-2-phenylethenyl]phosphoryl-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane (PubChem CID 6270737) has the molecular formula C26H30Cl2NOP and a molecular weight of 474.41 g/mol. Its IUPAC name is 6-bis[(Z)-2-chloro-2-phenylethenyl]phosphoryl-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane.
| Compound Name | 6-bis[(Z)-2-chloro-2-phenylethenyl]phosphoryl-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 6270737 |
| Molecular Formula | C26H30Cl2NOP |
| Molecular Weight | 474.41 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | 6-bis[(Z)-2-chloro-2-phenylethenyl]phosphoryl-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane |
| SMILES | CC1(C)CC2CC(C)(CN2P(=O)(/C=C(\Cl)c2ccccc2)/C=C(\Cl)c2ccccc2)C1 |
| InChI | InChI=1S/C26H30Cl2NOP/c1-25(2)14-22-15-26(3,18-25)19-29(22)31(30,16-23(27)20-10-6-4-7-11-20)17-24(28)21-12-8-5-9-13-21/h4-13,16-17,22H,14-15,18-19H2,1-3H3/b23-16-,24-17- |
| InChIKey | UZBBMJVJRGCNLR-KHFFFTKUSA-N |
| XLogP | 8.64 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.41 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|