C23H22N4 — CID 62707410
9-[3-(1H-benzimidazol-2-yl)propyl]-5,6,7,8-tetrahydrocarbazole-3-carbonitrile (PubChem CID 62707410) has the molecular formula C23H22N4 and a molecular weight of 354.46 g/mol. Its IUPAC name is 9-[3-(1H-benzimidazol-2-yl)propyl]-5,6,7,8-tetrahydrocarbazole-3-carbonitrile.
| Compound Name | 9-[3-(1H-benzimidazol-2-yl)propyl]-5,6,7,8-tetrahydrocarbazole-3-carbonitrile |
|---|---|
| PubChem CID | 62707410 |
| Molecular Formula | C23H22N4 |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 9-[3-(1H-benzimidazol-2-yl)propyl]-5,6,7,8-tetrahydrocarbazole-3-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)c1c(n2CCCc2nc3ccccc3[nH]2)CCCC1 |
| InChI | InChI=1S/C23H22N4/c24-15-16-11-12-22-18(14-16)17-6-1-4-9-21(17)27(22)13-5-10-23-25-19-7-2-3-8-20(19)26-23/h2-3,7-8,11-12,14H,1,4-6,9-10,13H2,(H,25,26) |
| InChIKey | INZZLTCMGWYMQT-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 57.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|