C31H52ClN — CID 62707446
7,9-bis[(E)-dec-1-enyl]-6,8-dimethyl-1,2,3,4-tetrahydroquinolizin-5-ium chloride (PubChem CID 62707446) has the molecular formula C31H52ClN and a molecular weight of 474.22 g/mol. Its IUPAC name is 7,9-bis[(E)-dec-1-enyl]-6,8-dimethyl-1,2,3,4-tetrahydroquinolizin-5-ium chloride.
| Compound Name | 7,9-bis[(E)-dec-1-enyl]-6,8-dimethyl-1,2,3,4-tetrahydroquinolizin-5-ium chloride |
|---|---|
| PubChem CID | 62707446 |
| Molecular Formula | C31H52ClN |
| Molecular Weight | 474.22 g/mol |
| Exact Mass | 473.38 |
| IUPAC Name | 7,9-bis[(E)-dec-1-enyl]-6,8-dimethyl-1,2,3,4-tetrahydroquinolizin-5-ium chloride |
| SMILES | CCCCCCCC/C=C/c1c(C)c(/C=C/CCCCCCCC)c2[n+](c1C)CCCC2.[Cl-] |
| InChI | InChI=1S/C31H52N.ClH/c1-5-7-9-11-13-15-17-19-23-29-27(3)30(24-20-18-16-14-12-10-8-6-2)31-25-21-22-26-32(31)28(29)4;/h19-20,23-24H,5-18,21-22,25-26H2,1-4H3;1H/q+1;/p-1/b23-19+,24-20+; |
| InChIKey | FDKHHCCWGSQPKU-QYFXLYKISA-M |
| XLogP | 6.46 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.22 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|