C32H58ClN — CID 62707598
1,3-didecyl-2,4-dimethyl-7,8,9,10-tetrahydro-6H-pyrido[1,2-a]azepin-5-ium chloride (PubChem CID 62707598) has the molecular formula C32H58ClN and a molecular weight of 492.28 g/mol. Its IUPAC name is 1,3-didecyl-2,4-dimethyl-7,8,9,10-tetrahydro-6H-pyrido[1,2-a]azepin-5-ium chloride.
| Compound Name | 1,3-didecyl-2,4-dimethyl-7,8,9,10-tetrahydro-6H-pyrido[1,2-a]azepin-5-ium chloride |
|---|---|
| PubChem CID | 62707598 |
| Molecular Formula | C32H58ClN |
| Molecular Weight | 492.28 g/mol |
| Exact Mass | 491.43 |
| IUPAC Name | 1,3-didecyl-2,4-dimethyl-7,8,9,10-tetrahydro-6H-pyrido[1,2-a]azepin-5-ium chloride |
| SMILES | CCCCCCCCCCc1c(C)c(CCCCCCCCCC)c2[n+](c1C)CCCCC2.[Cl-] |
| InChI | InChI=1S/C32H58N.ClH/c1-5-7-9-11-13-15-17-20-24-30-28(3)31(25-21-18-16-14-12-10-8-6-2)32-26-22-19-23-27-33(32)29(30)4;/h5-27H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | HDBDLNVCPWQJFA-UHFFFAOYSA-M |
| XLogP | 6.69 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.28 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|