About [2-[3,5-bis(trifluoromethyl)phenyl]-2-methylcyclopropyl]methanamine
[2-[3,5-bis(trifluoromethyl)phenyl]-2-methylcyclopropyl]methanamine (PubChem CID 62708708) has the molecular formula C13H13F6N
and a molecular weight of 297.24 g/mol. Its IUPAC name is [2-[3,5-bis(trifluoromethyl)phenyl]-2-methylcyclopropyl]methanamine.
Molecular Properties
| Compound Name | [2-[3,5-bis(trifluoromethyl)phenyl]-2-methylcyclopropyl]methanamine |
| PubChem CID | 62708708 |
| Molecular Formula | C13H13F6N |
| Molecular Weight | 297.24 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | [2-[3,5-bis(trifluoromethyl)phenyl]-2-methylcyclopropyl]methanamine |
| SMILES | CC1(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)CC1CN |
| InChI | InChI=1S/C13H13F6N/c1-11(5-10(11)6-20)7-2-8(12(14,15)16)4-9(3-7)13(17,18)19/h2-4,10H,5-6,20H2,1H3 |
| InChIKey | HUXJZPLXJPEPFE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.24 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [2-[3,5-bis(trifluoromethyl)phenyl]-2-methylcyclopropyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[3,5-bis(trifluoromethyl)phenyl]-2-methylcyclopropyl]methanamine?
The IUPAC name of [2-[3,5-bis(trifluoromethyl)phenyl]-2-methylcyclopropyl]methanamine (CID 62708708) is [2-[3,5-bis(trifluoromethyl)phenyl]-2-methylcyclopropyl]methanamine.
What is the SMILES notation for [2-[3,5-bis(trifluoromethyl)phenyl]-2-methylcyclopropyl]methanamine?
The canonical SMILES for [2-[3,5-bis(trifluoromethyl)phenyl]-2-methylcyclopropyl]methanamine is CC1(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)CC1CN.
What is the InChIKey of [2-[3,5-bis(trifluoromethyl)phenyl]-2-methylcyclopropyl]methanamine?
The InChIKey is HUXJZPLXJPEPFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13F6N/c1-11(5-10(11)6-20)7-2-8(12(14,15)16)4-9(3-7)13(17,18)19/h2-4,10H,5-6,20H2,1H3.
What are the key properties of [2-[3,5-bis(trifluoromethyl)phenyl]-2-methylcyclopropyl]methanamine?
[2-[3,5-bis(trifluoromethyl)phenyl]-2-methylcyclopropyl]methanamine has a molecular weight of 297.24 g/mol, XLogP of 3.96, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[3,5-bis(trifluoromethyl)phenyl]-2-methylcyclopropyl]methanamine is sourced from PubChem (CID 62708708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).