C16H14N4 — CID 62709741
2-(4-phenyl-1,2,4-triazol-3-yl)-2,3-dihydro-1H-indole (PubChem CID 62709741) has the molecular formula C16H14N4 and a molecular weight of 262.32 g/mol. Its IUPAC name is 2-(4-phenyl-1,2,4-triazol-3-yl)-2,3-dihydro-1H-indole.
| Compound Name | 2-(4-phenyl-1,2,4-triazol-3-yl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 62709741 |
| Molecular Formula | C16H14N4 |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 2-(4-phenyl-1,2,4-triazol-3-yl)-2,3-dihydro-1H-indole |
| SMILES | c1ccc(-n2cnnc2C2Cc3ccccc3N2)cc1 |
| InChI | InChI=1S/C16H14N4/c1-2-7-13(8-3-1)20-11-17-19-16(20)15-10-12-6-4-5-9-14(12)18-15/h1-9,11,15,18H,10H2 |
| InChIKey | KZAJXOQQLTVOBX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |