3-[2-(3,5-difluorophenyl)ethylamino]pyrazine-2-carboxylic acid

C13H11F2N3O2 — CID 62709799

IUPAC3-[2-(3,5-difluorophenyl)ethylamino]pyrazine-2-carboxylic acid
SMILESO=C(O)c1nccnc1NCCc1cc(F)cc(F)c1
InChIInChI=1S/C13H11F2N3O2/c14-9-5-8(6-10(15)7-9)1-2-17-12-11(13(19)20)16-3-4-18-12/h3-7H,1-2H2,(H,17,18)(H,19,20)
InChIKeyBSCNZEFUVNIOIW-UHFFFAOYSA-N
MW279.25 g/mol
LogP2.11
Rot. Bonds5

About 3-[2-(3,5-difluorophenyl)ethylamino]pyrazine-2-carboxylic acid

3-[2-(3,5-difluorophenyl)ethylamino]pyrazine-2-carboxylic acid (PubChem CID 62709799) has the molecular formula C13H11F2N3O2 and a molecular weight of 279.25 g/mol. Its IUPAC name is 3-[2-(3,5-difluorophenyl)ethylamino]pyrazine-2-carboxylic acid.

Molecular Properties

Compound Name3-[2-(3,5-difluorophenyl)ethylamino]pyrazine-2-carboxylic acid
PubChem CID62709799
Molecular FormulaC13H11F2N3O2
Molecular Weight279.25 g/mol
Exact Mass279.08
IUPAC Name3-[2-(3,5-difluorophenyl)ethylamino]pyrazine-2-carboxylic acid
SMILESO=C(O)c1nccnc1NCCc1cc(F)cc(F)c1
InChIInChI=1S/C13H11F2N3O2/c14-9-5-8(6-10(15)7-9)1-2-17-12-11(13(19)20)16-3-4-18-12/h3-7H,1-2H2,(H,17,18)(H,19,20)
InChIKeyBSCNZEFUVNIOIW-UHFFFAOYSA-N
XLogP2.11
TPSA75.11 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500279.25
LogP ≤ 52.11
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 3-[2-(3,5-difluorophenyl)ethylamino]pyrazine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[2-(3,5-difluorophenyl)ethylamino]pyrazine-2-carboxylic acid?
The IUPAC name of 3-[2-(3,5-difluorophenyl)ethylamino]pyrazine-2-carboxylic acid (CID 62709799) is 3-[2-(3,5-difluorophenyl)ethylamino]pyrazine-2-carboxylic acid.
What is the SMILES notation for 3-[2-(3,5-difluorophenyl)ethylamino]pyrazine-2-carboxylic acid?
The canonical SMILES for 3-[2-(3,5-difluorophenyl)ethylamino]pyrazine-2-carboxylic acid is O=C(O)c1nccnc1NCCc1cc(F)cc(F)c1.
What is the InChIKey of 3-[2-(3,5-difluorophenyl)ethylamino]pyrazine-2-carboxylic acid?
The InChIKey is BSCNZEFUVNIOIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11F2N3O2/c14-9-5-8(6-10(15)7-9)1-2-17-12-11(13(19)20)16-3-4-18-12/h3-7H,1-2H2,(H,17,18)(H,19,20).
What are the key properties of 3-[2-(3,5-difluorophenyl)ethylamino]pyrazine-2-carboxylic acid?
3-[2-(3,5-difluorophenyl)ethylamino]pyrazine-2-carboxylic acid has a molecular weight of 279.25 g/mol, XLogP of 2.11, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(3,5-difluorophenyl)ethylamino]pyrazine-2-carboxylic acid is sourced from PubChem (CID 62709799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).