C13H19NO3 — CID 62710496
2-(4-methoxybutylamino)-4-methylbenzoic acid (PubChem CID 62710496) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is 2-(4-methoxybutylamino)-4-methylbenzoic acid.
| Compound Name | 2-(4-methoxybutylamino)-4-methylbenzoic acid |
|---|---|
| PubChem CID | 62710496 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 2-(4-methoxybutylamino)-4-methylbenzoic acid |
| SMILES | COCCCCNc1cc(C)ccc1C(=O)O |
| InChI | InChI=1S/C13H19NO3/c1-10-5-6-11(13(15)16)12(9-10)14-7-3-4-8-17-2/h5-6,9,14H,3-4,7-8H2,1-2H3,(H,15,16) |
| InChIKey | SBIADYNDCPINII-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|