C16H20N4 — CID 62710580
5-(4-cyclohexyl-1,2,4-triazol-3-yl)-2,3-dihydro-1H-indole (PubChem CID 62710580) has the molecular formula C16H20N4 and a molecular weight of 268.36 g/mol. Its IUPAC name is 5-(4-cyclohexyl-1,2,4-triazol-3-yl)-2,3-dihydro-1H-indole.
| Compound Name | 5-(4-cyclohexyl-1,2,4-triazol-3-yl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 62710580 |
| Molecular Formula | C16H20N4 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 5-(4-cyclohexyl-1,2,4-triazol-3-yl)-2,3-dihydro-1H-indole |
| SMILES | c1cc2c(cc1-c1nncn1C1CCCCC1)CCN2 |
| InChI | InChI=1S/C16H20N4/c1-2-4-14(5-3-1)20-11-18-19-16(20)13-6-7-15-12(10-13)8-9-17-15/h6-7,10-11,14,17H,1-5,8-9H2 |
| InChIKey | KKXNJDCEVFYHIV-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |