C13H14N2O2S — CID 62710803
6-methyl-2-[(5-methylthiophen-2-yl)methylamino]pyridine-3-carboxylic acid (PubChem CID 62710803) has the molecular formula C13H14N2O2S and a molecular weight of 262.33 g/mol. Its IUPAC name is 6-methyl-2-[(5-methylthiophen-2-yl)methylamino]pyridine-3-carboxylic acid.
| Compound Name | 6-methyl-2-[(5-methylthiophen-2-yl)methylamino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 62710803 |
| Molecular Formula | C13H14N2O2S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 6-methyl-2-[(5-methylthiophen-2-yl)methylamino]pyridine-3-carboxylic acid |
| SMILES | Cc1ccc(C(=O)O)c(NCc2ccc(C)s2)n1 |
| InChI | InChI=1S/C13H14N2O2S/c1-8-3-6-11(13(16)17)12(15-8)14-7-10-5-4-9(2)18-10/h3-6H,7H2,1-2H3,(H,14,15)(H,16,17) |
| InChIKey | JBFRYSWXJAWFDR-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |