C17H16N4 — CID 62711092
5-(4-phenyl-1,2,4-triazol-3-yl)-1,2,3,4-tetrahydroquinoline (PubChem CID 62711092) has the molecular formula C17H16N4 and a molecular weight of 276.34 g/mol. Its IUPAC name is 5-(4-phenyl-1,2,4-triazol-3-yl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 5-(4-phenyl-1,2,4-triazol-3-yl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 62711092 |
| Molecular Formula | C17H16N4 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 5-(4-phenyl-1,2,4-triazol-3-yl)-1,2,3,4-tetrahydroquinoline |
| SMILES | c1ccc(-n2cnnc2-c2cccc3c2CCCN3)cc1 |
| InChI | InChI=1S/C17H16N4/c1-2-6-13(7-3-1)21-12-19-20-17(21)15-8-4-10-16-14(15)9-5-11-18-16/h1-4,6-8,10,12,18H,5,9,11H2 |
| InChIKey | HKFMMMSSLAYTSV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |