C11H17N3O2 — CID 62711324
3-(hexan-2-ylamino)pyrazine-2-carboxylic acid (PubChem CID 62711324) has the molecular formula C11H17N3O2 and a molecular weight of 223.28 g/mol. Its IUPAC name is 3-(hexan-2-ylamino)pyrazine-2-carboxylic acid.
| Compound Name | 3-(hexan-2-ylamino)pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 62711324 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | 3-(hexan-2-ylamino)pyrazine-2-carboxylic acid |
| SMILES | CCCCC(C)Nc1nccnc1C(=O)O |
| InChI | InChI=1S/C11H17N3O2/c1-3-4-5-8(2)14-10-9(11(15)16)12-6-7-13-10/h6-8H,3-5H2,1-2H3,(H,13,14)(H,15,16) |
| InChIKey | LUSPRXXWGKQCEU-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |