C36H26O2 — CID 6271135
(1Z,3Z,4Z,6Z)-1,3,4,6-tetrabenzylidene-3a,6a-dihydropentalene-2,5-dione (PubChem CID 6271135) has the molecular formula C36H26O2 and a molecular weight of 490.60 g/mol. Its IUPAC name is (1Z,3Z,4Z,6Z)-1,3,4,6-tetrabenzylidene-3a,6a-dihydropentalene-2,5-dione.
| Compound Name | (1Z,3Z,4Z,6Z)-1,3,4,6-tetrabenzylidene-3a,6a-dihydropentalene-2,5-dione |
|---|---|
| PubChem CID | 6271135 |
| Molecular Formula | C36H26O2 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | (1Z,3Z,4Z,6Z)-1,3,4,6-tetrabenzylidene-3a,6a-dihydropentalene-2,5-dione |
| SMILES | O=C1/C(=C\c2ccccc2)C2/C(=C/c3ccccc3)C(=O)/C(=C\c3ccccc3)C2/C1=C/c1ccccc1 |
| InChI | InChI=1S/C36H26O2/c37-35-29(21-25-13-5-1-6-14-25)33-30(22-26-15-7-2-8-16-26)36(38)32(24-28-19-11-4-12-20-28)34(33)31(35)23-27-17-9-3-10-18-27/h1-24,33-34H/b29-21-,30-22-,31-23-,32-24- |
| InChIKey | DHQCQYHJPBFOQY-ZKJAMNBOSA-N |
| XLogP | 7.72 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|