C10H11F3N2O4S — CID 62711833
4-(2-sulfamoylethylamino)-2-(trifluoromethyl)benzoic acid (PubChem CID 62711833) has the molecular formula C10H11F3N2O4S and a molecular weight of 312.27 g/mol. Its IUPAC name is 4-(2-sulfamoylethylamino)-2-(trifluoromethyl)benzoic acid.
| Compound Name | 4-(2-sulfamoylethylamino)-2-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 62711833 |
| Molecular Formula | C10H11F3N2O4S |
| Molecular Weight | 312.27 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 4-(2-sulfamoylethylamino)-2-(trifluoromethyl)benzoic acid |
| SMILES | NS(=O)(=O)CCNc1ccc(C(=O)O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H11F3N2O4S/c11-10(12,13)8-5-6(1-2-7(8)9(16)17)15-3-4-20(14,18)19/h1-2,5,15H,3-4H2,(H,16,17)(H2,14,18,19) |
| InChIKey | FDOQBLPYACRWOD-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.27 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |