About 2-(5-amino-3,4-dimethylpyrazol-1-yl)cyclohexan-1-ol
2-(5-amino-3,4-dimethylpyrazol-1-yl)cyclohexan-1-ol (PubChem CID 62712496) has the molecular formula C11H19N3O
and a molecular weight of 209.29 g/mol. Its IUPAC name is 2-(5-amino-3,4-dimethylpyrazol-1-yl)cyclohexan-1-ol.
Molecular Properties
| Compound Name | 2-(5-amino-3,4-dimethylpyrazol-1-yl)cyclohexan-1-ol |
| PubChem CID | 62712496 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 2-(5-amino-3,4-dimethylpyrazol-1-yl)cyclohexan-1-ol |
| SMILES | Cc1nn(C2CCCCC2O)c(N)c1C |
| InChI | InChI=1S/C11H19N3O/c1-7-8(2)13-14(11(7)12)9-5-3-4-6-10(9)15/h9-10,15H,3-6,12H2,1-2H3 |
| InChIKey | FOWZWYRQYLONDC-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(5-amino-3,4-dimethylpyrazol-1-yl)cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-amino-3,4-dimethylpyrazol-1-yl)cyclohexan-1-ol?
The IUPAC name of 2-(5-amino-3,4-dimethylpyrazol-1-yl)cyclohexan-1-ol (CID 62712496) is 2-(5-amino-3,4-dimethylpyrazol-1-yl)cyclohexan-1-ol.
What is the SMILES notation for 2-(5-amino-3,4-dimethylpyrazol-1-yl)cyclohexan-1-ol?
The canonical SMILES for 2-(5-amino-3,4-dimethylpyrazol-1-yl)cyclohexan-1-ol is Cc1nn(C2CCCCC2O)c(N)c1C.
What is the InChIKey of 2-(5-amino-3,4-dimethylpyrazol-1-yl)cyclohexan-1-ol?
The InChIKey is FOWZWYRQYLONDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O/c1-7-8(2)13-14(11(7)12)9-5-3-4-6-10(9)15/h9-10,15H,3-6,12H2,1-2H3.
What are the key properties of 2-(5-amino-3,4-dimethylpyrazol-1-yl)cyclohexan-1-ol?
2-(5-amino-3,4-dimethylpyrazol-1-yl)cyclohexan-1-ol has a molecular weight of 209.29 g/mol, XLogP of 1.56, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-amino-3,4-dimethylpyrazol-1-yl)cyclohexan-1-ol is sourced from PubChem (CID 62712496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).