C17H25ClN2 — CID 62712587
9-[(3-chlorophenyl)methyl]-N-ethyl-9-azabicyclo[3.3.1]nonan-3-amine (PubChem CID 62712587) has the molecular formula C17H25ClN2 and a molecular weight of 292.85 g/mol. Its IUPAC name is 9-[(3-chlorophenyl)methyl]-N-ethyl-9-azabicyclo[3.3.1]nonan-3-amine.
| Compound Name | 9-[(3-chlorophenyl)methyl]-N-ethyl-9-azabicyclo[3.3.1]nonan-3-amine |
|---|---|
| PubChem CID | 62712587 |
| Molecular Formula | C17H25ClN2 |
| Molecular Weight | 292.85 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 9-[(3-chlorophenyl)methyl]-N-ethyl-9-azabicyclo[3.3.1]nonan-3-amine |
| SMILES | CCNC1CC2CCCC(C1)N2Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C17H25ClN2/c1-2-19-15-10-16-7-4-8-17(11-15)20(16)12-13-5-3-6-14(18)9-13/h3,5-6,9,15-17,19H,2,4,7-8,10-12H2,1H3 |
| InChIKey | KJRDIMVXPUJQJQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.85 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |