C14H18FN — CID 62712800
N-[[2-(4-fluorophenyl)-2-methylcyclopropyl]methyl]cyclopropanamine (PubChem CID 62712800) has the molecular formula C14H18FN and a molecular weight of 219.30 g/mol. Its IUPAC name is N-[[2-(4-fluorophenyl)-2-methylcyclopropyl]methyl]cyclopropanamine.
| Compound Name | N-[[2-(4-fluorophenyl)-2-methylcyclopropyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 62712800 |
| Molecular Formula | C14H18FN |
| Molecular Weight | 219.30 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | N-[[2-(4-fluorophenyl)-2-methylcyclopropyl]methyl]cyclopropanamine |
| SMILES | CC1(c2ccc(F)cc2)CC1CNC1CC1 |
| InChI | InChI=1S/C14H18FN/c1-14(10-2-4-12(15)5-3-10)8-11(14)9-16-13-6-7-13/h2-5,11,13,16H,6-9H2,1H3 |
| InChIKey | PCMGZOUYKSFHKM-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |