C12H25N — CID 62714427
2-methyl-N-[(2-methyl-2-propylcyclopropyl)methyl]propan-1-amine (PubChem CID 62714427) has the molecular formula C12H25N and a molecular weight of 183.34 g/mol. Its IUPAC name is 2-methyl-N-[(2-methyl-2-propylcyclopropyl)methyl]propan-1-amine.
| Compound Name | 2-methyl-N-[(2-methyl-2-propylcyclopropyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 62714427 |
| Molecular Formula | C12H25N |
| Molecular Weight | 183.34 g/mol |
| Exact Mass | 183.20 |
| IUPAC Name | 2-methyl-N-[(2-methyl-2-propylcyclopropyl)methyl]propan-1-amine |
| SMILES | CCCC1(C)CC1CNCC(C)C |
| InChI | InChI=1S/C12H25N/c1-5-6-12(4)7-11(12)9-13-8-10(2)3/h10-11,13H,5-9H2,1-4H3 |
| InChIKey | IOIKVXIHYAJDFI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.34 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |