About 9-(3,5-dimethyl-1H-pyrazol-4-yl)-N-propyl-9-azabicyclo[3.3.1]nonan-3-amine
9-(3,5-dimethyl-1H-pyrazol-4-yl)-N-propyl-9-azabicyclo[3.3.1]nonan-3-amine (PubChem CID 62714531) has the molecular formula C16H28N4
and a molecular weight of 276.43 g/mol. Its IUPAC name is 9-(3,5-dimethyl-1H-pyrazol-4-yl)-N-propyl-9-azabicyclo[3.3.1]nonan-3-amine.
Molecular Properties
| Compound Name | 9-(3,5-dimethyl-1H-pyrazol-4-yl)-N-propyl-9-azabicyclo[3.3.1]nonan-3-amine |
| PubChem CID | 62714531 |
| Molecular Formula | C16H28N4 |
| Molecular Weight | 276.43 g/mol |
| Exact Mass | 276.23 |
| IUPAC Name | 9-(3,5-dimethyl-1H-pyrazol-4-yl)-N-propyl-9-azabicyclo[3.3.1]nonan-3-amine |
| SMILES | CCCNC1CC2CCCC(C1)N2c1c(C)n[nH]c1C |
| InChI | InChI=1S/C16H28N4/c1-4-8-17-13-9-14-6-5-7-15(10-13)20(14)16-11(2)18-19-12(16)3/h13-15,17H,4-10H2,1-3H3,(H,18,19) |
| InChIKey | UXKIQSCIGNNFKG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.43 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-(3,5-dimethyl-1H-pyrazol-4-yl)-N-propyl-9-azabicyclo[3.3.1]nonan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(3,5-dimethyl-1H-pyrazol-4-yl)-N-propyl-9-azabicyclo[3.3.1]nonan-3-amine?
The IUPAC name of 9-(3,5-dimethyl-1H-pyrazol-4-yl)-N-propyl-9-azabicyclo[3.3.1]nonan-3-amine (CID 62714531) is 9-(3,5-dimethyl-1H-pyrazol-4-yl)-N-propyl-9-azabicyclo[3.3.1]nonan-3-amine.
What is the SMILES notation for 9-(3,5-dimethyl-1H-pyrazol-4-yl)-N-propyl-9-azabicyclo[3.3.1]nonan-3-amine?
The canonical SMILES for 9-(3,5-dimethyl-1H-pyrazol-4-yl)-N-propyl-9-azabicyclo[3.3.1]nonan-3-amine is CCCNC1CC2CCCC(C1)N2c1c(C)n[nH]c1C.
What is the InChIKey of 9-(3,5-dimethyl-1H-pyrazol-4-yl)-N-propyl-9-azabicyclo[3.3.1]nonan-3-amine?
The InChIKey is UXKIQSCIGNNFKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28N4/c1-4-8-17-13-9-14-6-5-7-15(10-13)20(14)16-11(2)18-19-12(16)3/h13-15,17H,4-10H2,1-3H3,(H,18,19).
What are the key properties of 9-(3,5-dimethyl-1H-pyrazol-4-yl)-N-propyl-9-azabicyclo[3.3.1]nonan-3-amine?
9-(3,5-dimethyl-1H-pyrazol-4-yl)-N-propyl-9-azabicyclo[3.3.1]nonan-3-amine has a molecular weight of 276.43 g/mol, XLogP of 2.92, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(3,5-dimethyl-1H-pyrazol-4-yl)-N-propyl-9-azabicyclo[3.3.1]nonan-3-amine is sourced from PubChem (CID 62714531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).