C17H17N3O — CID 62715874
1-(3-naphthalen-1-yl-1,2,4-oxadiazol-5-yl)cyclopentan-1-amine (PubChem CID 62715874) has the molecular formula C17H17N3O and a molecular weight of 279.34 g/mol. Its IUPAC name is 1-(3-naphthalen-1-yl-1,2,4-oxadiazol-5-yl)cyclopentan-1-amine.
| Compound Name | 1-(3-naphthalen-1-yl-1,2,4-oxadiazol-5-yl)cyclopentan-1-amine |
|---|---|
| PubChem CID | 62715874 |
| Molecular Formula | C17H17N3O |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 1-(3-naphthalen-1-yl-1,2,4-oxadiazol-5-yl)cyclopentan-1-amine |
| SMILES | NC1(c2nc(-c3cccc4ccccc34)no2)CCCC1 |
| InChI | InChI=1S/C17H17N3O/c18-17(10-3-4-11-17)16-19-15(20-21-16)14-9-5-7-12-6-1-2-8-13(12)14/h1-2,5-9H,3-4,10-11,18H2 |
| InChIKey | VBWVZOUZDQRVKB-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |