C9H11N3O2 — CID 62716801
2-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]propan-1-amine (PubChem CID 62716801) has the molecular formula C9H11N3O2 and a molecular weight of 193.21 g/mol. Its IUPAC name is 2-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]propan-1-amine.
| Compound Name | 2-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]propan-1-amine |
|---|---|
| PubChem CID | 62716801 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 2-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]propan-1-amine |
| SMILES | CC(CN)c1nc(-c2ccco2)no1 |
| InChI | InChI=1S/C9H11N3O2/c1-6(5-10)9-11-8(12-14-9)7-3-2-4-13-7/h2-4,6H,5,10H2,1H3 |
| InChIKey | DCCOEOZJRPRNCV-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 78.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |