About 3-(3,4-dimethylphenyl)-2-phenylpyrrolidine
3-(3,4-dimethylphenyl)-2-phenylpyrrolidine (PubChem CID 62718437) has the molecular formula C18H21N
and a molecular weight of 251.37 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-2-phenylpyrrolidine.
Molecular Properties
| Compound Name | 3-(3,4-dimethylphenyl)-2-phenylpyrrolidine |
| PubChem CID | 62718437 |
| Molecular Formula | C18H21N |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-2-phenylpyrrolidine |
| SMILES | Cc1ccc(C2CCNC2c2ccccc2)cc1C |
| InChI | InChI=1S/C18H21N/c1-13-8-9-16(12-14(13)2)17-10-11-19-18(17)15-6-4-3-5-7-15/h3-9,12,17-19H,10-11H2,1-2H3 |
| InChIKey | RYNDSZCEBOLDQX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(3,4-dimethylphenyl)-2-phenylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dimethylphenyl)-2-phenylpyrrolidine?
The IUPAC name of 3-(3,4-dimethylphenyl)-2-phenylpyrrolidine (CID 62718437) is 3-(3,4-dimethylphenyl)-2-phenylpyrrolidine.
What is the SMILES notation for 3-(3,4-dimethylphenyl)-2-phenylpyrrolidine?
The canonical SMILES for 3-(3,4-dimethylphenyl)-2-phenylpyrrolidine is Cc1ccc(C2CCNC2c2ccccc2)cc1C.
What is the InChIKey of 3-(3,4-dimethylphenyl)-2-phenylpyrrolidine?
The InChIKey is RYNDSZCEBOLDQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N/c1-13-8-9-16(12-14(13)2)17-10-11-19-18(17)15-6-4-3-5-7-15/h3-9,12,17-19H,10-11H2,1-2H3.
What are the key properties of 3-(3,4-dimethylphenyl)-2-phenylpyrrolidine?
3-(3,4-dimethylphenyl)-2-phenylpyrrolidine has a molecular weight of 251.37 g/mol, XLogP of 4.12, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dimethylphenyl)-2-phenylpyrrolidine is sourced from PubChem (CID 62718437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).