About 2-methoxy-N-[[3-(1,3-thiazol-4-ylmethyl)oxolan-3-yl]methyl]ethanamine
2-methoxy-N-[[3-(1,3-thiazol-4-ylmethyl)oxolan-3-yl]methyl]ethanamine (PubChem CID 62718538) has the molecular formula C12H20N2O2S
and a molecular weight of 256.37 g/mol. Its IUPAC name is 2-methoxy-N-[[3-(1,3-thiazol-4-ylmethyl)oxolan-3-yl]methyl]ethanamine.
Molecular Properties
| Compound Name | 2-methoxy-N-[[3-(1,3-thiazol-4-ylmethyl)oxolan-3-yl]methyl]ethanamine |
| PubChem CID | 62718538 |
| Molecular Formula | C12H20N2O2S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 2-methoxy-N-[[3-(1,3-thiazol-4-ylmethyl)oxolan-3-yl]methyl]ethanamine |
| SMILES | COCCNCC1(Cc2cscn2)CCOC1 |
| InChI | InChI=1S/C12H20N2O2S/c1-15-5-3-13-8-12(2-4-16-9-12)6-11-7-17-10-14-11/h7,10,13H,2-6,8-9H2,1H3 |
| InChIKey | FXZHJKBAAGTHQL-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-N-[[3-(1,3-thiazol-4-ylmethyl)oxolan-3-yl]methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-N-[[3-(1,3-thiazol-4-ylmethyl)oxolan-3-yl]methyl]ethanamine?
The IUPAC name of 2-methoxy-N-[[3-(1,3-thiazol-4-ylmethyl)oxolan-3-yl]methyl]ethanamine (CID 62718538) is 2-methoxy-N-[[3-(1,3-thiazol-4-ylmethyl)oxolan-3-yl]methyl]ethanamine.
What is the SMILES notation for 2-methoxy-N-[[3-(1,3-thiazol-4-ylmethyl)oxolan-3-yl]methyl]ethanamine?
The canonical SMILES for 2-methoxy-N-[[3-(1,3-thiazol-4-ylmethyl)oxolan-3-yl]methyl]ethanamine is COCCNCC1(Cc2cscn2)CCOC1.
What is the InChIKey of 2-methoxy-N-[[3-(1,3-thiazol-4-ylmethyl)oxolan-3-yl]methyl]ethanamine?
The InChIKey is FXZHJKBAAGTHQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O2S/c1-15-5-3-13-8-12(2-4-16-9-12)6-11-7-17-10-14-11/h7,10,13H,2-6,8-9H2,1H3.
What are the key properties of 2-methoxy-N-[[3-(1,3-thiazol-4-ylmethyl)oxolan-3-yl]methyl]ethanamine?
2-methoxy-N-[[3-(1,3-thiazol-4-ylmethyl)oxolan-3-yl]methyl]ethanamine has a molecular weight of 256.37 g/mol, XLogP of 1.33, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-N-[[3-(1,3-thiazol-4-ylmethyl)oxolan-3-yl]methyl]ethanamine is sourced from PubChem (CID 62718538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).