C19H16N4 — CID 627189
6-(4-ethylphenyl)-2-phenylimidazo[1,2-b][1,2,4]triazine (PubChem CID 627189) has the molecular formula C19H16N4 and a molecular weight of 300.37 g/mol. Its IUPAC name is 6-(4-ethylphenyl)-2-phenylimidazo[1,2-b][1,2,4]triazine.
| Compound Name | 6-(4-ethylphenyl)-2-phenylimidazo[1,2-b][1,2,4]triazine |
|---|---|
| PubChem CID | 627189 |
| Molecular Formula | C19H16N4 |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 6-(4-ethylphenyl)-2-phenylimidazo[1,2-b][1,2,4]triazine |
| SMILES | CCc1ccc(-c2cn3nc(-c4ccccc4)cnc3n2)cc1 |
| InChI | InChI=1S/C19H16N4/c1-2-14-8-10-16(11-9-14)18-13-23-19(21-18)20-12-17(22-23)15-6-4-3-5-7-15/h3-13H,2H2,1H3 |
| InChIKey | KDDRHXQVNUBFHT-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |