C15H19ClN4 — CID 62721470
5-chloro-2-(5-cyclohexyl-2-methyl-1,2,4-triazol-3-yl)aniline (PubChem CID 62721470) has the molecular formula C15H19ClN4 and a molecular weight of 290.80 g/mol. Its IUPAC name is 5-chloro-2-(5-cyclohexyl-2-methyl-1,2,4-triazol-3-yl)aniline.
| Compound Name | 5-chloro-2-(5-cyclohexyl-2-methyl-1,2,4-triazol-3-yl)aniline |
|---|---|
| PubChem CID | 62721470 |
| Molecular Formula | C15H19ClN4 |
| Molecular Weight | 290.80 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 5-chloro-2-(5-cyclohexyl-2-methyl-1,2,4-triazol-3-yl)aniline |
| SMILES | Cn1nc(C2CCCCC2)nc1-c1ccc(Cl)cc1N |
| InChI | InChI=1S/C15H19ClN4/c1-20-15(12-8-7-11(16)9-13(12)17)18-14(19-20)10-5-3-2-4-6-10/h7-10H,2-6,17H2,1H3 |
| InChIKey | WWCUPMREJZGFIX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.80 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|