C11H22N4 — CID 62722491
6-(5-ethyl-2-methyl-1,2,4-triazol-3-yl)hexan-1-amine (PubChem CID 62722491) has the molecular formula C11H22N4 and a molecular weight of 210.32 g/mol. Its IUPAC name is 6-(5-ethyl-2-methyl-1,2,4-triazol-3-yl)hexan-1-amine.
| Compound Name | 6-(5-ethyl-2-methyl-1,2,4-triazol-3-yl)hexan-1-amine |
|---|---|
| PubChem CID | 62722491 |
| Molecular Formula | C11H22N4 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.18 |
| IUPAC Name | 6-(5-ethyl-2-methyl-1,2,4-triazol-3-yl)hexan-1-amine |
| SMILES | CCc1nc(CCCCCCN)n(C)n1 |
| InChI | InChI=1S/C11H22N4/c1-3-10-13-11(15(2)14-10)8-6-4-5-7-9-12/h3-9,12H2,1-2H3 |
| InChIKey | SYWVGEDPJGXRJK-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|