5-(5-cyclopentyl-2-methyl-1,2,4-triazol-3-yl)pentanoic acid

C13H21N3O2 — CID 62722724

IUPAC5-(5-cyclopentyl-2-methyl-1,2,4-triazol-3-yl)pentanoic acid
SMILESCn1nc(C2CCCC2)nc1CCCCC(=O)O
InChIInChI=1S/C13H21N3O2/c1-16-11(8-4-5-9-12(17)18)14-13(15-16)10-6-2-3-7-10/h10H,2-9H2,1H3,(H,17,18)
InChIKeyXGEAUBQOJXSYIB-UHFFFAOYSA-N
MW251.33 g/mol
LogP2.27
Rot. Bonds6

About 5-(5-cyclopentyl-2-methyl-1,2,4-triazol-3-yl)pentanoic acid

5-(5-cyclopentyl-2-methyl-1,2,4-triazol-3-yl)pentanoic acid (PubChem CID 62722724) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is 5-(5-cyclopentyl-2-methyl-1,2,4-triazol-3-yl)pentanoic acid.

Molecular Properties

Compound Name5-(5-cyclopentyl-2-methyl-1,2,4-triazol-3-yl)pentanoic acid
PubChem CID62722724
Molecular FormulaC13H21N3O2
Molecular Weight251.33 g/mol
Exact Mass251.16
IUPAC Name5-(5-cyclopentyl-2-methyl-1,2,4-triazol-3-yl)pentanoic acid
SMILESCn1nc(C2CCCC2)nc1CCCCC(=O)O
InChIInChI=1S/C13H21N3O2/c1-16-11(8-4-5-9-12(17)18)14-13(15-16)10-6-2-3-7-10/h10H,2-9H2,1H3,(H,17,18)
InChIKeyXGEAUBQOJXSYIB-UHFFFAOYSA-N
XLogP2.27
TPSA68.01 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500251.33
LogP ≤ 52.27
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 5-(5-cyclopentyl-2-methyl-1,2,4-triazol-3-yl)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(5-cyclopentyl-2-methyl-1,2,4-triazol-3-yl)pentanoic acid?
The IUPAC name of 5-(5-cyclopentyl-2-methyl-1,2,4-triazol-3-yl)pentanoic acid (CID 62722724) is 5-(5-cyclopentyl-2-methyl-1,2,4-triazol-3-yl)pentanoic acid.
What is the SMILES notation for 5-(5-cyclopentyl-2-methyl-1,2,4-triazol-3-yl)pentanoic acid?
The canonical SMILES for 5-(5-cyclopentyl-2-methyl-1,2,4-triazol-3-yl)pentanoic acid is Cn1nc(C2CCCC2)nc1CCCCC(=O)O.
What is the InChIKey of 5-(5-cyclopentyl-2-methyl-1,2,4-triazol-3-yl)pentanoic acid?
The InChIKey is XGEAUBQOJXSYIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3O2/c1-16-11(8-4-5-9-12(17)18)14-13(15-16)10-6-2-3-7-10/h10H,2-9H2,1H3,(H,17,18).
What are the key properties of 5-(5-cyclopentyl-2-methyl-1,2,4-triazol-3-yl)pentanoic acid?
5-(5-cyclopentyl-2-methyl-1,2,4-triazol-3-yl)pentanoic acid has a molecular weight of 251.33 g/mol, XLogP of 2.27, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-cyclopentyl-2-methyl-1,2,4-triazol-3-yl)pentanoic acid is sourced from PubChem (CID 62722724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).