About 6,8-dichloroindeno[1,2-b]quinoxalin-11-one
6,8-dichloroindeno[1,2-b]quinoxalin-11-one (PubChem CID 627229) has the molecular formula C15H6Cl2N2O
and a molecular weight of 301.13 g/mol. Its IUPAC name is 6,8-dichloroindeno[1,2-b]quinoxalin-11-one.
Molecular Properties
| Compound Name | 6,8-dichloroindeno[1,2-b]quinoxalin-11-one |
| PubChem CID | 627229 |
| Molecular Formula | C15H6Cl2N2O |
| Molecular Weight | 301.13 g/mol |
| Exact Mass | 299.99 |
| IUPAC Name | 6,8-dichloroindeno[1,2-b]quinoxalin-11-one |
| SMILES | O=C1c2ccccc2-c2nc3c(Cl)cc(Cl)cc3nc21 |
| InChI | InChI=1S/C15H6Cl2N2O/c16-7-5-10(17)13-11(6-7)18-14-12(19-13)8-3-1-2-4-9(8)15(14)20/h1-6H |
| InChIKey | KYSADBJPIRXTSX-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.13 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,8-dichloroindeno[1,2-b]quinoxalin-11-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-dichloroindeno[1,2-b]quinoxalin-11-one?
The IUPAC name of 6,8-dichloroindeno[1,2-b]quinoxalin-11-one (CID 627229) is 6,8-dichloroindeno[1,2-b]quinoxalin-11-one.
What is the SMILES notation for 6,8-dichloroindeno[1,2-b]quinoxalin-11-one?
The canonical SMILES for 6,8-dichloroindeno[1,2-b]quinoxalin-11-one is O=C1c2ccccc2-c2nc3c(Cl)cc(Cl)cc3nc21.
What is the InChIKey of 6,8-dichloroindeno[1,2-b]quinoxalin-11-one?
The InChIKey is KYSADBJPIRXTSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H6Cl2N2O/c16-7-5-10(17)13-11(6-7)18-14-12(19-13)8-3-1-2-4-9(8)15(14)20/h1-6H.
What are the key properties of 6,8-dichloroindeno[1,2-b]quinoxalin-11-one?
6,8-dichloroindeno[1,2-b]quinoxalin-11-one has a molecular weight of 301.13 g/mol, XLogP of 4.15, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dichloroindeno[1,2-b]quinoxalin-11-one is sourced from PubChem (CID 627229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).