C17H24O2S — CID 62722982
1-(4-methoxyphenyl)-2-(3-methylcyclohexyl)sulfanylpropan-1-one (PubChem CID 62722982) has the molecular formula C17H24O2S and a molecular weight of 292.44 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-2-(3-methylcyclohexyl)sulfanylpropan-1-one.
| Compound Name | 1-(4-methoxyphenyl)-2-(3-methylcyclohexyl)sulfanylpropan-1-one |
|---|---|
| PubChem CID | 62722982 |
| Molecular Formula | C17H24O2S |
| Molecular Weight | 292.44 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 1-(4-methoxyphenyl)-2-(3-methylcyclohexyl)sulfanylpropan-1-one |
| SMILES | COc1ccc(C(=O)C(C)SC2CCCC(C)C2)cc1 |
| InChI | InChI=1S/C17H24O2S/c1-12-5-4-6-16(11-12)20-13(2)17(18)14-7-9-15(19-3)10-8-14/h7-10,12-13,16H,4-6,11H2,1-3H3 |
| InChIKey | GZAXVNBZBYDUPT-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.44 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |