C13H17BrFN — CID 62723685
[1-[(2-bromo-5-fluorophenyl)methyl]cyclopentyl]methanamine (PubChem CID 62723685) has the molecular formula C13H17BrFN and a molecular weight of 286.19 g/mol. Its IUPAC name is [1-[(2-bromo-5-fluorophenyl)methyl]cyclopentyl]methanamine.
| Compound Name | [1-[(2-bromo-5-fluorophenyl)methyl]cyclopentyl]methanamine |
|---|---|
| PubChem CID | 62723685 |
| Molecular Formula | C13H17BrFN |
| Molecular Weight | 286.19 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | [1-[(2-bromo-5-fluorophenyl)methyl]cyclopentyl]methanamine |
| SMILES | NCC1(Cc2cc(F)ccc2Br)CCCC1 |
| InChI | InChI=1S/C13H17BrFN/c14-12-4-3-11(15)7-10(12)8-13(9-16)5-1-2-6-13/h3-4,7H,1-2,5-6,8-9,16H2 |
| InChIKey | BXZHQEHJZWTYFA-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.19 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |